C22H30N2O11S2 — CID 88558731
3,5-bis(3-aminoprop-1-ynyl)-4-propoxy-2,6-bis(3-sulfopropoxy)benzoic acid (PubChem CID 88558731) has the molecular formula C22H30N2O11S2 and a molecular weight of 562.62 g/mol. Its IUPAC name is 3,5-bis(3-aminoprop-1-ynyl)-4-propoxy-2,6-bis(3-sulfopropoxy)benzoic acid.
| Compound Name | 3,5-bis(3-aminoprop-1-ynyl)-4-propoxy-2,6-bis(3-sulfopropoxy)benzoic acid |
|---|---|
| PubChem CID | 88558731 |
| Molecular Formula | C22H30N2O11S2 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 3,5-bis(3-aminoprop-1-ynyl)-4-propoxy-2,6-bis(3-sulfopropoxy)benzoic acid |
| SMILES | CCCOc1c(C#CCN)c(OCCCS(=O)(=O)O)c(C(=O)O)c(OCCCS(=O)(=O)O)c1C#CCN |
| InChI | InChI=1S/C22H30N2O11S2/c1-2-11-33-19-16(7-3-9-23)20(34-12-5-14-36(27,28)29)18(22(25)26)21(17(19)8-4-10-24)35-13-6-15-37(30,31)32/h2,5-6,9-15,23-24H2,1H3,(H,25,26)(H,27,28,29)(H,30,31,32) |
| InChIKey | ZGZIVOSDPKHNPT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 225.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|