About 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid
3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (PubChem CID 88558751) has the molecular formula C17H24I2O11S2
and a molecular weight of 722.31 g/mol. Its IUPAC name is 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| PubChem CID | 88558751 |
| Molecular Formula | C17H24I2O11S2 |
| Molecular Weight | 722.31 g/mol |
| Exact Mass | 721.88 |
| IUPAC Name | 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| SMILES | CCCOc1c(I)c(OCCCS(=O)(=O)O)c(I)c(OCCCS(=O)(=O)O)c1C(=O)OC |
| InChI | InChI=1S/C17H24I2O11S2/c1-3-6-28-14-11(17(20)27-2)15(29-7-4-9-31(21,22)23)13(19)16(12(14)18)30-8-5-10-32(24,25)26/h3-10H2,1-2H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | GWAGYGLYLWRQCR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 722.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid?
The IUPAC name of 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (CID 88558751) is 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
What is the SMILES notation for 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid?
The canonical SMILES for 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid is CCCOc1c(I)c(OCCCS(=O)(=O)O)c(I)c(OCCCS(=O)(=O)O)c1C(=O)OC.
What is the InChIKey of 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid?
The InChIKey is GWAGYGLYLWRQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24I2O11S2/c1-3-6-28-14-11(17(20)27-2)15(29-7-4-9-31(21,22)23)13(19)16(12(14)18)30-8-5-10-32(24,25)26/h3-10H2,1-2H3,(H,21,22,23)(H,24,25,26).
What are the key properties of 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid?
3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid has a molecular weight of 722.31 g/mol, XLogP of 2.78, 14 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,4-diiodo-6-methoxycarbonyl-5-propoxy-3-(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid is sourced from PubChem (CID 88558751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).