About [(2S)-2,3-dihydroxypropyl]urea
[(2S)-2,3-dihydroxypropyl]urea (PubChem CID 88558799) has the molecular formula C4H10N2O3
and a molecular weight of 134.14 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl]urea.
Molecular Properties
| Compound Name | [(2S)-2,3-dihydroxypropyl]urea |
| PubChem CID | 88558799 |
| Molecular Formula | C4H10N2O3 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl]urea |
| SMILES | NC(=O)NC[C@H](O)CO |
| InChI | InChI=1S/C4H10N2O3/c5-4(9)6-1-3(8)2-7/h3,7-8H,1-2H2,(H3,5,6,9)/t3-/m0/s1 |
| InChIKey | IWJFGRNIFIABLP-VKHMYHEASA-N |
| XLogP | -1.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2,3-dihydroxypropyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2,3-dihydroxypropyl]urea?
The IUPAC name of [(2S)-2,3-dihydroxypropyl]urea (CID 88558799) is [(2S)-2,3-dihydroxypropyl]urea.
What is the SMILES notation for [(2S)-2,3-dihydroxypropyl]urea?
The canonical SMILES for [(2S)-2,3-dihydroxypropyl]urea is NC(=O)NC[C@H](O)CO.
What is the InChIKey of [(2S)-2,3-dihydroxypropyl]urea?
The InChIKey is IWJFGRNIFIABLP-VKHMYHEASA-N. The full InChI is InChI=1S/C4H10N2O3/c5-4(9)6-1-3(8)2-7/h3,7-8H,1-2H2,(H3,5,6,9)/t3-/m0/s1.
What are the key properties of [(2S)-2,3-dihydroxypropyl]urea?
[(2S)-2,3-dihydroxypropyl]urea has a molecular weight of 134.14 g/mol, XLogP of -1.99, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2,3-dihydroxypropyl]urea is sourced from PubChem (CID 88558799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).