C11H16O5 — CID 88558829
(3aR,7aR)-2,2-dimethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one (PubChem CID 88558829) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3aR,7aR)-2,2-dimethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7aR)-2,2-dimethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 88558829 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3aR,7aR)-2,2-dimethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
| SMILES | COOCC1=CC(=O)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C11H16O5/c1-11(2)15-9-5-7(6-14-13-3)4-8(12)10(9)16-11/h4,9-10H,5-6H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | ATJMDZBJZQGUDY-ZJUUUORDSA-N |
| XLogP | 0.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|