C13H20O5 — CID 88558831
(3aR,7aR)-2,2-diethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one (PubChem CID 88558831) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3aR,7aR)-2,2-diethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aR,7aR)-2,2-diethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 88558831 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3aR,7aR)-2,2-diethyl-6-(methylperoxymethyl)-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
| SMILES | CCC1(CC)O[C@@H]2CC(COOC)=CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H20O5/c1-4-13(5-2)17-11-7-9(8-16-15-3)6-10(14)12(11)18-13/h6,11-12H,4-5,7-8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | ZRVYOBUXYLTRIX-NEPJUHHUSA-N |
| XLogP | 1.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|