C18H17F4NO3 — CID 88558868
cis-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1R,3R)-3-[(E)-2-cyanoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88558868) has the molecular formula C18H17F4NO3 and a molecular weight of 371.33 g/mol. Its IUPAC name is cis-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1R,3R)-3-[(E)-2-cyanoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1R,3R)-3-[(E)-2-cyanoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88558868 |
| Molecular Formula | C18H17F4NO3 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | cis-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1R,3R)-3-[(E)-2-cyanoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C/C(C#N)=C\[C@@H]1[C@@H](C(=O)OCc2c(F)c(F)c(CO)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C18H17F4NO3/c1-8(5-23)4-11-12(18(11,2)3)17(25)26-7-10-15(21)13(19)9(6-24)14(20)16(10)22/h4,11-12,24H,6-7H2,1-3H3/b8-4+/t11-,12+/m1/s1 |
| InChIKey | NCDSXBHBYVMRIZ-QHSOFBSUSA-N |
| XLogP | 3.52 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|