About 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol
1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol (PubChem CID 88559171) has the molecular formula C14H20ClN5O
and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol |
| PubChem CID | 88559171 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CN1CCC(n2nnc3cc(Cl)ncc32)CC1 |
| InChI | InChI=1S/C14H20ClN5O/c1-14(2,21)9-19-5-3-10(4-6-19)20-12-8-16-13(15)7-11(12)17-18-20/h7-8,10,21H,3-6,9H2,1-2H3 |
| InChIKey | JQJOAJPESWNARF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol?
The IUPAC name of 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol (CID 88559171) is 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol?
The canonical SMILES for 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol is CC(C)(O)CN1CCC(n2nnc3cc(Cl)ncc32)CC1.
What is the InChIKey of 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol?
The InChIKey is JQJOAJPESWNARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN5O/c1-14(2,21)9-19-5-3-10(4-6-19)20-12-8-16-13(15)7-11(12)17-18-20/h7-8,10,21H,3-6,9H2,1-2H3.
What are the key properties of 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol?
1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol has a molecular weight of 309.80 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-chlorotriazolo[4,5-c]pyridin-3-yl)piperidin-1-yl]-2-methylpropan-2-ol is sourced from PubChem (CID 88559171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).