C7H10F4O2S — CID 88559369
2-(2,2,3,3-tetrafluoropropyl)thiolane 1,1-dioxide (PubChem CID 88559369) has the molecular formula C7H10F4O2S and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropyl)thiolane 1,1-dioxide.
| Compound Name | 2-(2,2,3,3-tetrafluoropropyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 88559369 |
| Molecular Formula | C7H10F4O2S |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H10F4O2S/c8-6(9)7(10,11)4-5-2-1-3-14(5,12)13/h5-6H,1-4H2 |
| InChIKey | QTTUUIYEACANPW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|