C28H55NO — CID 88559669
(2R,12Z,15Z)-1-hexoxy-N-methylhenicosa-12,15-dien-2-amine (PubChem CID 88559669) has the molecular formula C28H55NO and a molecular weight of 421.75 g/mol. Its IUPAC name is (2R,12Z,15Z)-1-hexoxy-N-methylhenicosa-12,15-dien-2-amine.
| Compound Name | (2R,12Z,15Z)-1-hexoxy-N-methylhenicosa-12,15-dien-2-amine |
|---|---|
| PubChem CID | 88559669 |
| Molecular Formula | C28H55NO |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.43 |
| IUPAC Name | (2R,12Z,15Z)-1-hexoxy-N-methylhenicosa-12,15-dien-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC[C@H](COCCCCCC)NC |
| InChI | InChI=1S/C28H55NO/c1-4-6-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-28(29-3)27-30-26-24-9-7-5-2/h11-12,14-15,28-29H,4-10,13,16-27H2,1-3H3/b12-11-,15-14-/t28-/m1/s1 |
| InChIKey | ROBLYQWCGQITSW-OWYZKHJNSA-N |
| XLogP | 8.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|