C53H54N2O4 — CID 88559792
3-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-9-[3-[3-[5-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-3-ethynyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]carbazole (PubChem CID 88559792) has the molecular formula C53H54N2O4 and a molecular weight of 783.03 g/mol. Its IUPAC name is 3-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-9-[3-[3-[5-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-3-ethynyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]carbazole.
| Compound Name | 3-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-9-[3-[3-[5-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-3-ethynyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 88559792 |
| Molecular Formula | C53H54N2O4 |
| Molecular Weight | 783.03 g/mol |
| Exact Mass | 782.41 |
| IUPAC Name | 3-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-9-[3-[3-[5-[2-[(3-ethyloxetan-3-yl)methoxy]ethyl]-3-ethynyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]carbazole |
| SMILES | C#Cc1c(/C=C\C)n(-c2cccc(-c3cccc(-n4c5ccccc5c5cc(CCOCC6(CC)COC6)ccc54)c3)c2)c2ccc(CCOCC3(CC)COC3)cc12 |
| InChI | InChI=1S/C53H54N2O4/c1-5-13-48-44(6-2)46-28-38(24-26-56-32-52(7-3)34-58-35-52)20-22-50(46)54(48)42-16-11-14-40(30-42)41-15-12-17-43(31-41)55-49-19-10-9-18-45(49)47-29-39(21-23-51(47)55)25-27-57-33-53(8-4)36-59-37-53/h2,5,9-23,28-31H,7-8,24-27,32-37H2,1,3-4H3/b13-5- |
| InChIKey | OBAJGWWJKBLBGP-ACAGNQJTSA-N |
| XLogP | 11.38 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.03 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|