About 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate
2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 88559899) has the molecular formula C16H25FO4
and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 88559899 |
| Molecular Formula | C16H25FO4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC(C(=O)OCCF)C1C2 |
| InChI | InChI=1S/C16H25FO4/c1-4-16(2,3)15(19)21-13-9-10-7-11(13)12(8-10)14(18)20-6-5-17/h10-13H,4-9H2,1-3H3 |
| InChIKey | XNZWKLJGEIFFFR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (CID 88559899) is 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate is CCC(C)(C)C(=O)OC1CC2CC(C(=O)OCCF)C1C2.
What is the InChIKey of 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is XNZWKLJGEIFFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FO4/c1-4-16(2,3)15(19)21-13-9-10-7-11(13)12(8-10)14(18)20-6-5-17/h10-13H,4-9H2,1-3H3.
What are the key properties of 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate?
2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 300.37 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 88559899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).