About 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid
3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid (PubChem CID 88560266) has the molecular formula C21H19F6NO4
and a molecular weight of 463.37 g/mol. Its IUPAC name is 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid.
Molecular Properties
| Compound Name | 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid |
| PubChem CID | 88560266 |
| Molecular Formula | C21H19F6NO4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid |
| SMILES | CC(Oc1cc(C(F)(F)F)ccc1C(F)(F)F)C(=O)Nc1ccc(C(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C21H19F6NO4/c1-11(9-18(29)30)13-3-6-15(7-4-13)28-19(31)12(2)32-17-10-14(20(22,23)24)5-8-16(17)21(25,26)27/h3-8,10-12H,9H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | VQKUXPBTNRWHIM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid?
The IUPAC name of 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid (CID 88560266) is 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid.
What is the SMILES notation for 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid?
The canonical SMILES for 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid is CC(Oc1cc(C(F)(F)F)ccc1C(F)(F)F)C(=O)Nc1ccc(C(C)CC(=O)O)cc1.
What is the InChIKey of 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid?
The InChIKey is VQKUXPBTNRWHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F6NO4/c1-11(9-18(29)30)13-3-6-15(7-4-13)28-19(31)12(2)32-17-10-14(20(22,23)24)5-8-16(17)21(25,26)27/h3-8,10-12H,9H2,1-2H3,(H,28,31)(H,29,30).
What are the key properties of 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid?
3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid has a molecular weight of 463.37 g/mol, XLogP of 5.71, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-[2,5-bis(trifluoromethyl)phenoxy]propanoylamino]phenyl]butanoic acid is sourced from PubChem (CID 88560266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).