About (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol
(3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol (PubChem CID 88560312) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol.
Molecular Properties
| Compound Name | (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol |
| PubChem CID | 88560312 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(C)=C(C)C |
| InChI | InChI=1S/C9H14O/c1-7(2)8(3)5-6-9(4)10/h5-6,10H,4H2,1-3H3/b6-5- |
| InChIKey | JAGPOJZNUAZJSN-WAYWQWQTSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol?
The IUPAC name of (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol (CID 88560312) is (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol.
What is the SMILES notation for (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol?
The canonical SMILES for (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol is C=C(O)/C=C\C(C)=C(C)C.
What is the InChIKey of (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol?
The InChIKey is JAGPOJZNUAZJSN-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H14O/c1-7(2)8(3)5-6-9(4)10/h5-6,10H,4H2,1-3H3/b6-5-.
What are the key properties of (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol?
(3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol has a molecular weight of 138.21 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5,6-dimethylhepta-1,3,5-trien-2-ol is sourced from PubChem (CID 88560312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).