About 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine
1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine (PubChem CID 88560391) has the molecular formula C9H14IN
and a molecular weight of 263.12 g/mol. Its IUPAC name is 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine.
Molecular Properties
| Compound Name | 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine |
| PubChem CID | 88560391 |
| Molecular Formula | C9H14IN |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C=C(C=C)/N=C/I(C)C |
| InChI | InChI=1S/C9H14IN/c1-5-7-9(6-2)11-8-10(3)4/h5-8H,1-2H2,3-4H3/b9-7+,11-8+ |
| InChIKey | MYJZSFOGPROXTA-BIZFVBGRSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine?
The IUPAC name of 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine (CID 88560391) is 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine.
What is the SMILES notation for 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine?
The canonical SMILES for 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine is C=C/C=C(C=C)/N=C/I(C)C.
What is the InChIKey of 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine?
The InChIKey is MYJZSFOGPROXTA-BIZFVBGRSA-N. The full InChI is InChI=1S/C9H14IN/c1-5-7-9(6-2)11-8-10(3)4/h5-8H,1-2H2,3-4H3/b9-7+,11-8+.
What are the key properties of 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine?
1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine has a molecular weight of 263.12 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethyl-λ3-iodanyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]methanimine is sourced from PubChem (CID 88560391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).