C15H28O2 — CID 88560420
3-methyl-1-(2,2,5,5-tetramethylhexan-3-yloxy)but-3-en-2-one (PubChem CID 88560420) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-methyl-1-(2,2,5,5-tetramethylhexan-3-yloxy)but-3-en-2-one.
| Compound Name | 3-methyl-1-(2,2,5,5-tetramethylhexan-3-yloxy)but-3-en-2-one |
|---|---|
| PubChem CID | 88560420 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-methyl-1-(2,2,5,5-tetramethylhexan-3-yloxy)but-3-en-2-one |
| SMILES | C=C(C)C(=O)COC(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28O2/c1-11(2)12(16)10-17-13(15(6,7)8)9-14(3,4)5/h13H,1,9-10H2,2-8H3 |
| InChIKey | GIZGXZPMLQCHNI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|