About 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide
2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide (PubChem CID 88560556) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide.
Molecular Properties
| Compound Name | 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide |
| PubChem CID | 88560556 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide |
| SMILES | C=CCNC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO/c1-8-9-15-12(16)11(14(5,6)7)10-13(2,3)4/h8,11H,1,9-10H2,2-7H3,(H,15,16) |
| InChIKey | LLZWAHWTOHWCHZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide?
The IUPAC name of 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide (CID 88560556) is 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide.
What is the SMILES notation for 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide?
The canonical SMILES for 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide is C=CCNC(=O)C(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide?
The InChIKey is LLZWAHWTOHWCHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-8-9-15-12(16)11(14(5,6)7)10-13(2,3)4/h8,11H,1,9-10H2,2-7H3,(H,15,16).
What are the key properties of 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide?
2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide has a molecular weight of 225.38 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,4-dimethyl-N-prop-2-enylpentanamide is sourced from PubChem (CID 88560556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).