C10H13ClN2O2 — CID 88560810
1-(5-chloro-2-methylphenyl)-3-ethyl-1-hydroxyurea (PubChem CID 88560810) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-ethyl-1-hydroxyurea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-ethyl-1-hydroxyurea |
|---|---|
| PubChem CID | 88560810 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-ethyl-1-hydroxyurea |
| SMILES | CCNC(=O)N(O)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C10H13ClN2O2/c1-3-12-10(14)13(15)9-6-8(11)5-4-7(9)2/h4-6,15H,3H2,1-2H3,(H,12,14) |
| InChIKey | RRGLAZILMIDGAC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|