About 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide
4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide (PubChem CID 88560919) has the molecular formula C10H14N4O4S
and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide |
| PubChem CID | 88560919 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(CCN=O)CCN=O)cc1 |
| InChI | InChI=1S/C10H14N4O4S/c11-9-1-3-10(4-2-9)19(17,18)14(7-5-12-15)8-6-13-16/h1-4H,5-8,11H2 |
| InChIKey | LBBPMMWFUDIXMV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide?
The IUPAC name of 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide (CID 88560919) is 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide.
What is the SMILES notation for 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide?
The canonical SMILES for 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide is Nc1ccc(S(=O)(=O)N(CCN=O)CCN=O)cc1.
What is the InChIKey of 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide?
The InChIKey is LBBPMMWFUDIXMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O4S/c11-9-1-3-10(4-2-9)19(17,18)14(7-5-12-15)8-6-13-16/h1-4H,5-8,11H2.
What are the key properties of 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide?
4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide has a molecular weight of 286.31 g/mol, XLogP of 0.79, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N-bis(2-nitrosoethyl)benzenesulfonamide is sourced from PubChem (CID 88560919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).