C8H6F10O2 — CID 88561034
(1,2,2,3,3,4,5,5,6,6-decafluoro-4-methoxycyclohexyl)methanol (PubChem CID 88561034) has the molecular formula C8H6F10O2 and a molecular weight of 324.11 g/mol. Its IUPAC name is (1,2,2,3,3,4,5,5,6,6-decafluoro-4-methoxycyclohexyl)methanol.
| Compound Name | (1,2,2,3,3,4,5,5,6,6-decafluoro-4-methoxycyclohexyl)methanol |
|---|---|
| PubChem CID | 88561034 |
| Molecular Formula | C8H6F10O2 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (1,2,2,3,3,4,5,5,6,6-decafluoro-4-methoxycyclohexyl)methanol |
| SMILES | COC1(F)C(F)(F)C(F)(F)C(F)(CO)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H6F10O2/c1-20-8(18)6(14,15)4(10,11)3(9,2-19)5(12,13)7(8,16)17/h19H,2H2,1H3 |
| InChIKey | RFJCGMDGASDIOY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|