C20H14F5NO3 — CID 88561126
2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-8-[(E)-prop-1-enyl]-1,4-benzoxazin-3-one (PubChem CID 88561126) has the molecular formula C20H14F5NO3 and a molecular weight of 411.33 g/mol. Its IUPAC name is 2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-8-[(E)-prop-1-enyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-8-[(E)-prop-1-enyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 88561126 |
| Molecular Formula | C20H14F5NO3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-8-[(E)-prop-1-enyl]-1,4-benzoxazin-3-one |
| SMILES | C/C=C/c1cccc2c1OC(CC)C(=O)N2C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H14F5NO3/c1-3-6-9-7-5-8-10-18(9)29-11(4-2)19(27)26(10)20(28)12-13(21)15(23)17(25)16(24)14(12)22/h3,5-8,11H,4H2,1-2H3/b6-3+ |
| InChIKey | LHXWDTUNADYMBW-ZZXKWVIFSA-N |
| XLogP | 4.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|