C17H24F3NO8S — CID 88561180
[2-(3-carboxyoxypropyl)-5-[(2R)-2-cyanopropyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]methyl trifluoromethanesulfonate (PubChem CID 88561180) has the molecular formula C17H24F3NO8S and a molecular weight of 459.44 g/mol. Its IUPAC name is [2-(3-carboxyoxypropyl)-5-[(2R)-2-cyanopropyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]methyl trifluoromethanesulfonate.
| Compound Name | [2-(3-carboxyoxypropyl)-5-[(2R)-2-cyanopropyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88561180 |
| Molecular Formula | C17H24F3NO8S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [2-(3-carboxyoxypropyl)-5-[(2R)-2-cyanopropyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]methyl trifluoromethanesulfonate |
| SMILES | CC(C#N)CC1CCC2OC(CCCOC(=O)O)C(COS(=O)(=O)C(F)(F)F)C2O1 |
| InChI | InChI=1S/C17H24F3NO8S/c1-10(8-21)7-11-4-5-14-15(28-11)12(9-27-30(24,25)17(18,19)20)13(29-14)3-2-6-26-16(22)23/h10-15H,2-7,9H2,1H3,(H,22,23) |
| InChIKey | PMLUBJAIFDKEFV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|