C15H15N — CID 88561271
(2E,3Z)-2-[(2Z,4Z)-hepta-2,4,6-trienylidene]-3-prop-2-enylidenepyridine (PubChem CID 88561271) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is (2E,3Z)-2-[(2Z,4Z)-hepta-2,4,6-trienylidene]-3-prop-2-enylidenepyridine.
| Compound Name | (2E,3Z)-2-[(2Z,4Z)-hepta-2,4,6-trienylidene]-3-prop-2-enylidenepyridine |
|---|---|
| PubChem CID | 88561271 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2E,3Z)-2-[(2Z,4Z)-hepta-2,4,6-trienylidene]-3-prop-2-enylidenepyridine |
| SMILES | C=C/C=C\C=C/C=c1/nccc/c1=C/C=C |
| InChI | InChI=1S/C15H15N/c1-3-5-6-7-8-12-15-14(10-4-2)11-9-13-16-15/h3-13H,1-2H2/b6-5-,8-7-,14-10-,15-12+ |
| InChIKey | OGXIZJXLASQCOU-VFKAKFQKSA-N |
| XLogP | 2.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|