C31H32N6O3S2 — CID 88561505
N-[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[(2R)-1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrrolidin-2-yl]benzamide (PubChem CID 88561505) has the molecular formula C31H32N6O3S2 and a molecular weight of 600.77 g/mol. Its IUPAC name is N-[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[(2R)-1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrrolidin-2-yl]benzamide.
| Compound Name | N-[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[(2R)-1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrrolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 88561505 |
| Molecular Formula | C31H32N6O3S2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | N-[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[(2R)-1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrrolidin-2-yl]benzamide |
| SMILES | O=C(Nc1nc2c(s1)C[C@@H](N1CCOCC1)CC2)c1cccc([C@H]2CCCN2C(=O)c2csc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C31H32N6O3S2/c38-28(35-31-34-24-9-8-23(17-27(24)42-31)36-12-14-40-15-13-36)21-5-1-4-20(16-21)26-7-3-11-37(26)30(39)25-19-41-29(33-25)22-6-2-10-32-18-22/h1-2,4-6,10,16,18-19,23,26H,3,7-9,11-15,17H2,(H,34,35,38)/t23-,26+/m0/s1 |
| InChIKey | NBALCAPIKLXBDV-JYFHCDHNSA-N |
| XLogP | 5.08 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |