C12H15F9O3 — CID 88562008
2-(1-butan-2-yloxy-2-methoxyethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane (PubChem CID 88562008) has the molecular formula C12H15F9O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 2-(1-butan-2-yloxy-2-methoxyethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane.
| Compound Name | 2-(1-butan-2-yloxy-2-methoxyethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane |
|---|---|
| PubChem CID | 88562008 |
| Molecular Formula | C12H15F9O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(1-butan-2-yloxy-2-methoxyethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane |
| SMILES | CCC(C)OC(COC)C1(F)OC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H15F9O3/c1-4-6(2)23-7(5-22-3)8(13)9(14,15)10(16,17)11(18,19)12(20,21)24-8/h6-7H,4-5H2,1-3H3 |
| InChIKey | NIXGKQGVAAQGPV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|