C22H20N6O5 — CID 88562028
5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(5-methylpyrazin-2-yl)carbamoyl]phenoxy]pyrazine-2-carbonyl cyanide (PubChem CID 88562028) has the molecular formula C22H20N6O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is 5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(5-methylpyrazin-2-yl)carbamoyl]phenoxy]pyrazine-2-carbonyl cyanide.
| Compound Name | 5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(5-methylpyrazin-2-yl)carbamoyl]phenoxy]pyrazine-2-carbonyl cyanide |
|---|---|
| PubChem CID | 88562028 |
| Molecular Formula | C22H20N6O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 5-[3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(5-methylpyrazin-2-yl)carbamoyl]phenoxy]pyrazine-2-carbonyl cyanide |
| SMILES | COC[C@H](C)Oc1cc(Oc2cnc(C(=O)C#N)cn2)cc(C(=O)Nc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C22H20N6O5/c1-13-8-26-20(10-24-13)28-22(30)15-4-16(32-14(2)12-31-3)6-17(5-15)33-21-11-25-18(9-27-21)19(29)7-23/h4-6,8-11,14H,12H2,1-3H3,(H,26,28,30)/t14-/m0/s1 |
| InChIKey | YWMYTUAGQMKLHZ-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|