About (10E)-N-butylheptadeca-1,10-dien-2-amine
(10E)-N-butylheptadeca-1,10-dien-2-amine (PubChem CID 88562107) has the molecular formula C21H41N
and a molecular weight of 307.57 g/mol. Its IUPAC name is (10E)-N-butylheptadeca-1,10-dien-2-amine.
Molecular Properties
| Compound Name | (10E)-N-butylheptadeca-1,10-dien-2-amine |
| PubChem CID | 88562107 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | (10E)-N-butylheptadeca-1,10-dien-2-amine |
| SMILES | C=C(CCCCCCC/C=C/CCCCCC)NCCCC |
| InChI | InChI=1S/C21H41N/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-21(3)22-20-7-5-2/h11-12,22H,3-10,13-20H2,1-2H3/b12-11+ |
| InChIKey | FNJBRZVWCGDNHS-VAWYXSNFSA-N |
| XLogP | 7.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (10E)-N-butylheptadeca-1,10-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10E)-N-butylheptadeca-1,10-dien-2-amine?
The IUPAC name of (10E)-N-butylheptadeca-1,10-dien-2-amine (CID 88562107) is (10E)-N-butylheptadeca-1,10-dien-2-amine.
What is the SMILES notation for (10E)-N-butylheptadeca-1,10-dien-2-amine?
The canonical SMILES for (10E)-N-butylheptadeca-1,10-dien-2-amine is C=C(CCCCCCC/C=C/CCCCCC)NCCCC.
What is the InChIKey of (10E)-N-butylheptadeca-1,10-dien-2-amine?
The InChIKey is FNJBRZVWCGDNHS-VAWYXSNFSA-N. The full InChI is InChI=1S/C21H41N/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-21(3)22-20-7-5-2/h11-12,22H,3-10,13-20H2,1-2H3/b12-11+.
What are the key properties of (10E)-N-butylheptadeca-1,10-dien-2-amine?
(10E)-N-butylheptadeca-1,10-dien-2-amine has a molecular weight of 307.57 g/mol, XLogP of 7.15, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (10E)-N-butylheptadeca-1,10-dien-2-amine is sourced from PubChem (CID 88562107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).