C24H36O5 — CID 88562286
(2S,3R,4S,5S,6S)-2-[(2E,4Z,7Z)-7-ethenyl-10-methyl-5-prop-1-en-2-ylundeca-2,4,7,9-tetraen-3-yl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol (PubChem CID 88562286) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-[(2E,4Z,7Z)-7-ethenyl-10-methyl-5-prop-1-en-2-ylundeca-2,4,7,9-tetraen-3-yl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6S)-2-[(2E,4Z,7Z)-7-ethenyl-10-methyl-5-prop-1-en-2-ylundeca-2,4,7,9-tetraen-3-yl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 88562286 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-[(2E,4Z,7Z)-7-ethenyl-10-methyl-5-prop-1-en-2-ylundeca-2,4,7,9-tetraen-3-yl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
| SMILES | C=C/C(=C\C=C(C)C)C/C(=C/C(=C\C)[C@]1(C)O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=C)C |
| InChI | InChI=1S/C24H36O5/c1-8-17(11-10-15(3)4)12-18(16(5)6)13-19(9-2)24(7)23(28)22(27)21(26)20(14-25)29-24/h8-11,13,20-23,25-28H,1,5,12,14H2,2-4,6-7H3/b17-11+,18-13-,19-9+/t20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | JXKAKDIVSPTSSK-UXRLOHHXSA-N |
| XLogP | 3.14 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|