C25H24F5N3O8 — CID 88562465
3-[[(2S)-2-[[2-[4-(fluoromethoxy)anilino]-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 88562465) has the molecular formula C25H24F5N3O8 and a molecular weight of 589.47 g/mol. Its IUPAC name is 3-[[(2S)-2-[[2-[4-(fluoromethoxy)anilino]-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 3-[[(2S)-2-[[2-[4-(fluoromethoxy)anilino]-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 88562465 |
| Molecular Formula | C25H24F5N3O8 |
| Molecular Weight | 589.47 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | 3-[[(2S)-2-[[2-[4-(fluoromethoxy)anilino]-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C(=O)Nc1ccc(OCF)cc1)C(=O)NC(CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C25H24F5N3O8/c1-11(2)21(33-25(39)24(38)31-12-3-5-13(6-4-12)41-10-26)23(37)32-16(8-18(35)36)17(34)9-40-22-19(29)14(27)7-15(28)20(22)30/h3-7,11,16,21H,8-10H2,1-2H3,(H,31,38)(H,32,37)(H,33,39)(H,35,36)/t16?,21-/m0/s1 |
| InChIKey | GSORWGRYRSFBIB-MRNPHLECSA-N |
| XLogP | 2.24 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|