C19H16F6N4O3 — CID 88562720
N'-[(1Z)-1-[6-oxo-2-(2,2,2-trifluoroethoxy)-1-[4-(2,2,2-trifluoroethoxy)phenyl]pyrimidin-4-yl]buta-1,3-dienyl]methanimidamide (PubChem CID 88562720) has the molecular formula C19H16F6N4O3 and a molecular weight of 462.35 g/mol. Its IUPAC name is N'-[(1Z)-1-[6-oxo-2-(2,2,2-trifluoroethoxy)-1-[4-(2,2,2-trifluoroethoxy)phenyl]pyrimidin-4-yl]buta-1,3-dienyl]methanimidamide.
| Compound Name | N'-[(1Z)-1-[6-oxo-2-(2,2,2-trifluoroethoxy)-1-[4-(2,2,2-trifluoroethoxy)phenyl]pyrimidin-4-yl]buta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 88562720 |
| Molecular Formula | C19H16F6N4O3 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N'-[(1Z)-1-[6-oxo-2-(2,2,2-trifluoroethoxy)-1-[4-(2,2,2-trifluoroethoxy)phenyl]pyrimidin-4-yl]buta-1,3-dienyl]methanimidamide |
| SMILES | C=C/C=C(\N=C\N)c1cc(=O)n(-c2ccc(OCC(F)(F)F)cc2)c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C19H16F6N4O3/c1-2-3-14(27-11-26)15-8-16(30)29(17(28-15)32-10-19(23,24)25)12-4-6-13(7-5-12)31-9-18(20,21)22/h2-8,11H,1,9-10H2,(H2,26,27)/b14-3- |
| InChIKey | SATZMFFSDNMKMQ-BNNQUZSASA-N |
| XLogP | 3.63 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|