C21H22NO9P — CID 88563030
(2S,3R,4S,4aR)-2,3,4-trihydroxy-7-[methyl(phenoxy)phosphoryl]oxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 88563030) has the molecular formula C21H22NO9P and a molecular weight of 463.38 g/mol. Its IUPAC name is (2S,3R,4S,4aR)-2,3,4-trihydroxy-7-[methyl(phenoxy)phosphoryl]oxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | (2S,3R,4S,4aR)-2,3,4-trihydroxy-7-[methyl(phenoxy)phosphoryl]oxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 88563030 |
| Molecular Formula | C21H22NO9P |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (2S,3R,4S,4aR)-2,3,4-trihydroxy-7-[methyl(phenoxy)phosphoryl]oxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | CP(=O)(Oc1ccccc1)Oc1c2c(cc3c1C(=O)N[C@@H]1C3C[C@H](O)[C@@H](O)[C@H]1O)OCO2 |
| InChI | InChI=1S/C21H22NO9P/c1-32(27,30-10-5-3-2-4-6-10)31-20-15-11(8-14-19(20)29-9-28-14)12-7-13(23)17(24)18(25)16(12)22-21(15)26/h2-6,8,12-13,16-18,23-25H,7,9H2,1H3,(H,22,26)/t12?,13-,16+,17+,18-,32?/m0/s1 |
| InChIKey | JDOZCBLLRHOSJO-ALWCAWCESA-N |
| XLogP | 1.38 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|