About 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene
6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene (PubChem CID 88563171) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene.
Molecular Properties
| Compound Name | 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene |
| PubChem CID | 88563171 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene |
| SMILES | CC1C2=C(N=CC2)C1C |
| InChI | InChI=1S/C8H11N/c1-5-6(2)8-7(5)3-4-9-8/h4-6H,3H2,1-2H3 |
| InChIKey | AJBYRKHWLGSWNN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The IUPAC name of 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene (CID 88563171) is 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene.
What is the SMILES notation for 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The canonical SMILES for 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene is CC1C2=C(N=CC2)C1C.
What is the InChIKey of 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The InChIKey is AJBYRKHWLGSWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-5-6(2)8-7(5)3-4-9-8/h4-6H,3H2,1-2H3.
What are the key properties of 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene has a molecular weight of 121.18 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2-azabicyclo[3.2.0]hepta-1(5),2-diene is sourced from PubChem (CID 88563171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).