C34H48I2O28S6 — CID 88563307
3-[4-iodo-2-[3-iodo-5-methoxycarbonyl-2,4,6-tris(3-sulfopropoxy)phenyl]-6-methoxycarbonyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (PubChem CID 88563307) has the molecular formula C34H48I2O28S6 and a molecular weight of 1350.94 g/mol. Its IUPAC name is 3-[4-iodo-2-[3-iodo-5-methoxycarbonyl-2,4,6-tris(3-sulfopropoxy)phenyl]-6-methoxycarbonyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-iodo-2-[3-iodo-5-methoxycarbonyl-2,4,6-tris(3-sulfopropoxy)phenyl]-6-methoxycarbonyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88563307 |
| Molecular Formula | C34H48I2O28S6 |
| Molecular Weight | 1350.94 g/mol |
| Exact Mass | 1349.87 |
| IUPAC Name | 3-[4-iodo-2-[3-iodo-5-methoxycarbonyl-2,4,6-tris(3-sulfopropoxy)phenyl]-6-methoxycarbonyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| SMILES | COC(=O)c1c(OCCCS(=O)(=O)O)c(I)c(OCCCS(=O)(=O)O)c(-c2c(OCCCS(=O)(=O)O)c(I)c(OCCCS(=O)(=O)O)c(C(=O)OC)c2OCCCS(=O)(=O)O)c1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C34H48I2O28S6/c1-57-33(37)23-27(59-9-3-15-65(39,40)41)21(29(61-11-5-17-67(45,46)47)25(35)31(23)63-13-7-19-69(51,52)53)22-28(60-10-4-16-66(42,43)44)24(34(38)58-2)32(64-14-8-20-70(54,55)56)26(36)30(22)62-12-6-18-68(48,49)50/h3-20H2,1-2H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50)(H,51,52,53)(H,54,55,56) |
| InChIKey | KPUPSBUMUGCWOU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 434.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1350.94 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|