About (3R,4S)-3,4-dimethyloxolane-2-thiol
(3R,4S)-3,4-dimethyloxolane-2-thiol (PubChem CID 88563389) has the molecular formula C6H12OS
and a molecular weight of 132.23 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethyloxolane-2-thiol.
Molecular Properties
| Compound Name | (3R,4S)-3,4-dimethyloxolane-2-thiol |
| PubChem CID | 88563389 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | (3R,4S)-3,4-dimethyloxolane-2-thiol |
| SMILES | C[C@@H]1COC(S)[C@@H]1C |
| InChI | InChI=1S/C6H12OS/c1-4-3-7-6(8)5(4)2/h4-6,8H,3H2,1-2H3/t4-,5-,6?/m1/s1 |
| InChIKey | ZZEZEFBFFIEFML-QYRBDRAASA-N |
| XLogP | 1.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3,4-dimethyloxolane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3,4-dimethyloxolane-2-thiol?
The IUPAC name of (3R,4S)-3,4-dimethyloxolane-2-thiol (CID 88563389) is (3R,4S)-3,4-dimethyloxolane-2-thiol.
What is the SMILES notation for (3R,4S)-3,4-dimethyloxolane-2-thiol?
The canonical SMILES for (3R,4S)-3,4-dimethyloxolane-2-thiol is C[C@@H]1COC(S)[C@@H]1C.
What is the InChIKey of (3R,4S)-3,4-dimethyloxolane-2-thiol?
The InChIKey is ZZEZEFBFFIEFML-QYRBDRAASA-N. The full InChI is InChI=1S/C6H12OS/c1-4-3-7-6(8)5(4)2/h4-6,8H,3H2,1-2H3/t4-,5-,6?/m1/s1.
What are the key properties of (3R,4S)-3,4-dimethyloxolane-2-thiol?
(3R,4S)-3,4-dimethyloxolane-2-thiol has a molecular weight of 132.23 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-dimethyloxolane-2-thiol is sourced from PubChem (CID 88563389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).