C6H7FIN — CID 88563736
(1Z,3E)-5-fluoro-4-iodohexa-1,3,5-trien-1-amine (PubChem CID 88563736) has the molecular formula C6H7FIN and a molecular weight of 239.03 g/mol. Its IUPAC name is (1Z,3E)-5-fluoro-4-iodohexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-5-fluoro-4-iodohexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88563736 |
| Molecular Formula | C6H7FIN |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | (1Z,3E)-5-fluoro-4-iodohexa-1,3,5-trien-1-amine |
| SMILES | C=C(F)/C(I)=C\C=C/N |
| InChI | InChI=1S/C6H7FIN/c1-5(7)6(8)3-2-4-9/h2-4H,1,9H2/b4-2-,6-3+ |
| InChIKey | USCGZQOJNOGPKX-MDNDHVJUSA-N |
| XLogP | 2.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|