About (1Z)-3-ethoxybuta-1,3-dien-1-amine
(1Z)-3-ethoxybuta-1,3-dien-1-amine (PubChem CID 88563912) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is (1Z)-3-ethoxybuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z)-3-ethoxybuta-1,3-dien-1-amine |
| PubChem CID | 88563912 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (1Z)-3-ethoxybuta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\N)OCC |
| InChI | InChI=1S/C6H11NO/c1-3-8-6(2)4-5-7/h4-5H,2-3,7H2,1H3/b5-4- |
| InChIKey | IHXMLQQLIAMSNB-PLNGDYQASA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3-ethoxybuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3-ethoxybuta-1,3-dien-1-amine?
The IUPAC name of (1Z)-3-ethoxybuta-1,3-dien-1-amine (CID 88563912) is (1Z)-3-ethoxybuta-1,3-dien-1-amine.
What is the SMILES notation for (1Z)-3-ethoxybuta-1,3-dien-1-amine?
The canonical SMILES for (1Z)-3-ethoxybuta-1,3-dien-1-amine is C=C(/C=C\N)OCC.
What is the InChIKey of (1Z)-3-ethoxybuta-1,3-dien-1-amine?
The InChIKey is IHXMLQQLIAMSNB-PLNGDYQASA-N. The full InChI is InChI=1S/C6H11NO/c1-3-8-6(2)4-5-7/h4-5H,2-3,7H2,1H3/b5-4-.
What are the key properties of (1Z)-3-ethoxybuta-1,3-dien-1-amine?
(1Z)-3-ethoxybuta-1,3-dien-1-amine has a molecular weight of 113.16 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3-ethoxybuta-1,3-dien-1-amine is sourced from PubChem (CID 88563912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).