C17H18F6N2O2Si — CID 88564104
4-[2-oxo-5-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 88564104) has the molecular formula C17H18F6N2O2Si and a molecular weight of 424.42 g/mol. Its IUPAC name is 4-[2-oxo-5-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-oxo-5-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 88564104 |
| Molecular Formula | C17H18F6N2O2Si |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-[2-oxo-5-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[Si](C)(C)OC(C1CCC(=O)N1c1ccc(C#N)c(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C17H18F6N2O2Si/c1-28(2,3)27-15(17(21,22)23)13-6-7-14(26)25(13)11-5-4-10(9-24)12(8-11)16(18,19)20/h4-5,8,13,15H,6-7H2,1-3H3 |
| InChIKey | DUGCWLFUNPBPQX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|