About [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate
[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 88564534) has the molecular formula C17H26O6
and a molecular weight of 326.39 g/mol. Its IUPAC name is [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
Molecular Properties
| Compound Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| PubChem CID | 88564534 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | CC1=C(CCC(=O)OC(C)(C)CCOC(C)(C)C)C(=O)OC1=O |
| InChI | InChI=1S/C17H26O6/c1-11-12(15(20)22-14(11)19)7-8-13(18)23-17(5,6)9-10-21-16(2,3)4/h7-10H2,1-6H3 |
| InChIKey | NIPQOCGCISKFCQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate?
The IUPAC name of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (CID 88564534) is [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
What is the SMILES notation for [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate?
The canonical SMILES for [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate is CC1=C(CCC(=O)OC(C)(C)CCOC(C)(C)C)C(=O)OC1=O.
What is the InChIKey of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate?
The InChIKey is NIPQOCGCISKFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O6/c1-11-12(15(20)22-14(11)19)7-8-13(18)23-17(5,6)9-10-21-16(2,3)4/h7-10H2,1-6H3.
What are the key properties of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate?
[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate has a molecular weight of 326.39 g/mol, XLogP of 2.69, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate is sourced from PubChem (CID 88564534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).