C15H23N — CID 88565366
(3Z,5Z,7Z,9Z)-N,N,2,6-tetramethylundeca-1,3,5,7,9-pentaen-5-amine (PubChem CID 88565366) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (3Z,5Z,7Z,9Z)-N,N,2,6-tetramethylundeca-1,3,5,7,9-pentaen-5-amine.
| Compound Name | (3Z,5Z,7Z,9Z)-N,N,2,6-tetramethylundeca-1,3,5,7,9-pentaen-5-amine |
|---|---|
| PubChem CID | 88565366 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3Z,5Z,7Z,9Z)-N,N,2,6-tetramethylundeca-1,3,5,7,9-pentaen-5-amine |
| SMILES | C=C(C)/C=C\C(=C(C)\C=C/C=C\C)N(C)C |
| InChI | InChI=1S/C15H23N/c1-7-8-9-10-14(4)15(16(5)6)12-11-13(2)3/h7-12H,2H2,1,3-6H3/b8-7-,10-9-,12-11-,15-14- |
| InChIKey | FGBAEUCYSLTZFY-NKWRMCJFSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|