About N-iodo-3-methyl-1,2-oxazol-5-amine
N-iodo-3-methyl-1,2-oxazol-5-amine (PubChem CID 88565628) has the molecular formula C4H5IN2O
and a molecular weight of 224.00 g/mol. Its IUPAC name is N-iodo-3-methyl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | N-iodo-3-methyl-1,2-oxazol-5-amine |
| PubChem CID | 88565628 |
| Molecular Formula | C4H5IN2O |
| Molecular Weight | 224.00 g/mol |
| Exact Mass | 223.94 |
| IUPAC Name | N-iodo-3-methyl-1,2-oxazol-5-amine |
| SMILES | Cc1cc(NI)on1 |
| InChI | InChI=1S/C4H5IN2O/c1-3-2-4(6-5)8-7-3/h2,6H,1H3 |
| InChIKey | HPIJFBJXNVHMNJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.00 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-3-methyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-3-methyl-1,2-oxazol-5-amine?
The IUPAC name of N-iodo-3-methyl-1,2-oxazol-5-amine (CID 88565628) is N-iodo-3-methyl-1,2-oxazol-5-amine.
What is the SMILES notation for N-iodo-3-methyl-1,2-oxazol-5-amine?
The canonical SMILES for N-iodo-3-methyl-1,2-oxazol-5-amine is Cc1cc(NI)on1.
What is the InChIKey of N-iodo-3-methyl-1,2-oxazol-5-amine?
The InChIKey is HPIJFBJXNVHMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5IN2O/c1-3-2-4(6-5)8-7-3/h2,6H,1H3.
What are the key properties of N-iodo-3-methyl-1,2-oxazol-5-amine?
N-iodo-3-methyl-1,2-oxazol-5-amine has a molecular weight of 224.00 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-3-methyl-1,2-oxazol-5-amine is sourced from PubChem (CID 88565628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).