C18H13ClN2O2S2 — CID 8856571
N-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 8856571) has the molecular formula C18H13ClN2O2S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 8856571 |
| Molecular Formula | C18H13ClN2O2S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | N-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C18H13ClN2O2S2/c1-12(22)21(14-5-3-2-4-6-14)18-20-13(11-24-18)7-8-15(23)16-9-10-17(19)25-16/h2-11H,1H3/b8-7+ |
| InChIKey | OBIQDEINLYNFAN-BQYQJAHWSA-N |
| XLogP | 5.44 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|