C13H18ClF3N4O3 — CID 88566242
(1R,2S,3R,5R)-3-[[6-chloro-5-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 88566242) has the molecular formula C13H18ClF3N4O3 and a molecular weight of 370.76 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[6-chloro-5-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[6-chloro-5-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 88566242 |
| Molecular Formula | C13H18ClF3N4O3 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[6-chloro-5-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1c(Cl)nc(NCC(F)(F)F)nc1N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18ClF3N4O3/c1-5-10(14)20-12(18-4-13(15,16)17)21-11(5)19-7-2-6(3-22)8(23)9(7)24/h6-9,22-24H,2-4H2,1H3,(H2,18,19,20,21)/t6-,7-,8-,9+/m1/s1 |
| InChIKey | VCTFHRLWWNSMBO-BGZDPUMWSA-N |
| XLogP | 0.93 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |