C21H20ClN5OS — CID 88566254
[(1R,3S)-3-[[2-amino-6-chloro-5-[2-(5-pyridin-3-ylthiophen-2-yl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 88566254) has the molecular formula C21H20ClN5OS and a molecular weight of 425.95 g/mol. Its IUPAC name is [(1R,3S)-3-[[2-amino-6-chloro-5-[2-(5-pyridin-3-ylthiophen-2-yl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[2-amino-6-chloro-5-[2-(5-pyridin-3-ylthiophen-2-yl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 88566254 |
| Molecular Formula | C21H20ClN5OS |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [(1R,3S)-3-[[2-amino-6-chloro-5-[2-(5-pyridin-3-ylthiophen-2-yl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Nc1nc(Cl)c(C#Cc2ccc(-c3cccnc3)s2)c(N[C@H]2CC[C@@H](CO)C2)n1 |
| InChI | InChI=1S/C21H20ClN5OS/c22-19-17(7-5-16-6-8-18(29-16)14-2-1-9-24-11-14)20(27-21(23)26-19)25-15-4-3-13(10-15)12-28/h1-2,6,8-9,11,13,15,28H,3-4,10,12H2,(H3,23,25,26,27)/t13-,15+/m1/s1 |
| InChIKey | DVVWPEIKWHOHIA-HIFRSBDPSA-N |
| XLogP | 3.81 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|