C23H39NO — CID 88566400
2-[[(6Z,9Z,12Z,15Z)-henicosa-1,6,9,12,15-pentaen-2-yl]amino]ethanol (PubChem CID 88566400) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is 2-[[(6Z,9Z,12Z,15Z)-henicosa-1,6,9,12,15-pentaen-2-yl]amino]ethanol.
| Compound Name | 2-[[(6Z,9Z,12Z,15Z)-henicosa-1,6,9,12,15-pentaen-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 88566400 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 2-[[(6Z,9Z,12Z,15Z)-henicosa-1,6,9,12,15-pentaen-2-yl]amino]ethanol |
| SMILES | C=C(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)NCCO |
| InChI | InChI=1S/C23H39NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(2)24-21-22-25/h7-8,10-11,13-14,16-17,24-25H,2-6,9,12,15,18-22H2,1H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | NXUBCONLMLWXNG-ZKWNWVNESA-N |
| XLogP | 6.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|