C22H29F3INO4Si — CID 88566430
(4R)-4-benzyl-3-[(Z,2S)-6,6,6-trifluoro-5-iodo-2-triethylsilyloxyhex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 88566430) has the molecular formula C22H29F3INO4Si and a molecular weight of 583.46 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(Z,2S)-6,6,6-trifluoro-5-iodo-2-triethylsilyloxyhex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(Z,2S)-6,6,6-trifluoro-5-iodo-2-triethylsilyloxyhex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 88566430 |
| Molecular Formula | C22H29F3INO4Si |
| Molecular Weight | 583.46 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | (4R)-4-benzyl-3-[(Z,2S)-6,6,6-trifluoro-5-iodo-2-triethylsilyloxyhex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C=C(\I)C(F)(F)F)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H29F3INO4Si/c1-4-32(5-2,6-3)31-18(12-13-19(26)22(23,24)25)20(28)27-17(15-30-21(27)29)14-16-10-8-7-9-11-16/h7-11,13,17-18H,4-6,12,14-15H2,1-3H3/b19-13-/t17-,18+/m1/s1 |
| InChIKey | CXBGKIIDUVCDHP-FHMALFGCSA-N |
| XLogP | 6.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|