C15H25F3O2Si — CID 88566435
(3S,5E)-3-triethylsilyloxy-6-(trifluoromethyl)octa-5,7-dien-2-one (PubChem CID 88566435) has the molecular formula C15H25F3O2Si and a molecular weight of 322.44 g/mol. Its IUPAC name is (3S,5E)-3-triethylsilyloxy-6-(trifluoromethyl)octa-5,7-dien-2-one.
| Compound Name | (3S,5E)-3-triethylsilyloxy-6-(trifluoromethyl)octa-5,7-dien-2-one |
|---|---|
| PubChem CID | 88566435 |
| Molecular Formula | C15H25F3O2Si |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3S,5E)-3-triethylsilyloxy-6-(trifluoromethyl)octa-5,7-dien-2-one |
| SMILES | C=C/C(=C\C[C@H](O[Si](CC)(CC)CC)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C15H25F3O2Si/c1-6-13(15(16,17)18)10-11-14(12(5)19)20-21(7-2,8-3)9-4/h6,10,14H,1,7-9,11H2,2-5H3/b13-10+/t14-/m0/s1 |
| InChIKey | DVNRGEAKUMJOBD-UELRPHRMSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|