C15H20O3 — CID 88566476
(2S)-5-methoxy-2-[(2S,3E,5E)-4-methylocta-3,5,7-trien-2-yl]-2,3-dihydropyran-6-one (PubChem CID 88566476) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2S)-5-methoxy-2-[(2S,3E,5E)-4-methylocta-3,5,7-trien-2-yl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-5-methoxy-2-[(2S,3E,5E)-4-methylocta-3,5,7-trien-2-yl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 88566476 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2S)-5-methoxy-2-[(2S,3E,5E)-4-methylocta-3,5,7-trien-2-yl]-2,3-dihydropyran-6-one |
| SMILES | C=C/C=C/C(C)=C/[C@H](C)[C@@H]1CC=C(OC)C(=O)O1 |
| InChI | InChI=1S/C15H20O3/c1-5-6-7-11(2)10-12(3)13-8-9-14(17-4)15(16)18-13/h5-7,9-10,12-13H,1,8H2,2-4H3/b7-6+,11-10+/t12-,13-/m0/s1 |
| InChIKey | NVPRWILIOCHKNH-FUAFTNLQSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|