C17H15F9O — CID 88566580
2,3-difluoro-4-[1,1,2,2-tetrafluoro-2-(2,3,3-trifluoro-4-methyl-1-bicyclo[2.2.2]octanyl)ethyl]phenol (PubChem CID 88566580) has the molecular formula C17H15F9O and a molecular weight of 406.29 g/mol. Its IUPAC name is 2,3-difluoro-4-[1,1,2,2-tetrafluoro-2-(2,3,3-trifluoro-4-methyl-1-bicyclo[2.2.2]octanyl)ethyl]phenol.
| Compound Name | 2,3-difluoro-4-[1,1,2,2-tetrafluoro-2-(2,3,3-trifluoro-4-methyl-1-bicyclo[2.2.2]octanyl)ethyl]phenol |
|---|---|
| PubChem CID | 88566580 |
| Molecular Formula | C17H15F9O |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2,3-difluoro-4-[1,1,2,2-tetrafluoro-2-(2,3,3-trifluoro-4-methyl-1-bicyclo[2.2.2]octanyl)ethyl]phenol |
| SMILES | CC12CCC(C(F)(F)C(F)(F)c3ccc(O)c(F)c3F)(CC1)C(F)C2(F)F |
| InChI | InChI=1S/C17H15F9O/c1-13-4-6-14(7-5-13,12(20)16(13,23)24)17(25,26)15(21,22)8-2-3-9(27)11(19)10(8)18/h2-3,12,27H,4-7H2,1H3 |
| InChIKey | GKDYRUZIBGMPCO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|