C15H17F7O4S — CID 88566608
[2,2,3,3-tetrafluoro-4-(4-hydroxycyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate (PubChem CID 88566608) has the molecular formula C15H17F7O4S and a molecular weight of 426.35 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-4-(4-hydroxycyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate.
| Compound Name | [2,2,3,3-tetrafluoro-4-(4-hydroxycyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88566608 |
| Molecular Formula | C15H17F7O4S |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [2,2,3,3-tetrafluoro-4-(4-hydroxycyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC12CCC(C3CC=C(O)CC3)(CC1)C(F)(F)C2(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H17F7O4S/c16-13(17)11(9-1-3-10(23)4-2-9)5-7-12(8-6-11,14(13,18)19)26-27(24,25)15(20,21)22/h3,9,23H,1-2,4-8H2 |
| InChIKey | YIBPMNXJGMVTPP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|