About (4S)-cyclohexa-1,5-diene-1,4-dithiol
(4S)-cyclohexa-1,5-diene-1,4-dithiol (PubChem CID 88566638) has the molecular formula C6H8S2
and a molecular weight of 144.26 g/mol. Its IUPAC name is (4S)-cyclohexa-1,5-diene-1,4-dithiol.
Molecular Properties
| Compound Name | (4S)-cyclohexa-1,5-diene-1,4-dithiol |
| PubChem CID | 88566638 |
| Molecular Formula | C6H8S2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | (4S)-cyclohexa-1,5-diene-1,4-dithiol |
| SMILES | SC1=CC[C@H](S)C=C1 |
| InChI | InChI=1S/C6H8S2/c7-5-1-2-6(8)4-3-5/h1-3,6-8H,4H2/t6-/m1/s1 |
| InChIKey | AJOLDBFGRKRSPF-ZCFIWIBFSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4S)-cyclohexa-1,5-diene-1,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-cyclohexa-1,5-diene-1,4-dithiol?
The IUPAC name of (4S)-cyclohexa-1,5-diene-1,4-dithiol (CID 88566638) is (4S)-cyclohexa-1,5-diene-1,4-dithiol.
What is the SMILES notation for (4S)-cyclohexa-1,5-diene-1,4-dithiol?
The canonical SMILES for (4S)-cyclohexa-1,5-diene-1,4-dithiol is SC1=CC[C@H](S)C=C1.
What is the InChIKey of (4S)-cyclohexa-1,5-diene-1,4-dithiol?
The InChIKey is AJOLDBFGRKRSPF-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H8S2/c7-5-1-2-6(8)4-3-5/h1-3,6-8H,4H2/t6-/m1/s1.
What are the key properties of (4S)-cyclohexa-1,5-diene-1,4-dithiol?
(4S)-cyclohexa-1,5-diene-1,4-dithiol has a molecular weight of 144.26 g/mol, XLogP of 2.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-cyclohexa-1,5-diene-1,4-dithiol is sourced from PubChem (CID 88566638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).