C13H12F4O9S — CID 88566766
1,1,1,2-tetrafluoro-3-oxo-3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]propane-2-sulfonic acid (PubChem CID 88566766) has the molecular formula C13H12F4O9S and a molecular weight of 420.29 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-oxo-3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]propane-2-sulfonic acid.
| Compound Name | 1,1,1,2-tetrafluoro-3-oxo-3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 88566766 |
| Molecular Formula | C13H12F4O9S |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-oxo-3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]propane-2-sulfonic acid |
| SMILES | O=C(COC(=O)C(F)(C(F)(F)F)S(=O)(=O)O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C13H12F4O9S/c14-12(13(15,16)17,27(21,22)23)11(20)24-3-7(18)25-8-4-1-5-6(2-4)10(19)26-9(5)8/h4-6,8-9H,1-3H2,(H,21,22,23) |
| InChIKey | GLYJGDJCAFQBPM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|